cas: 3057-91-8 — see every product listed under this CAS number, including other names
Spiro[3.3]heptane-2,6-dicarboxylic acid, 96% (CAS 3057-91-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F602466-100MG |
| cas | 3057-91-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 310.33 Pln | |
| Fluorochem | 250mg | 508.17 Pln | |
| Fluorochem | 1g | 1294.35 Pln | |
| Fluorochem | 5g | 3887.19 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
Spiro[3.3]heptane-2,6-dicarboxylic acid (CAS 3057-91-8) is a chemical compound with the molecular formula C9H12O4 and a molecular weight of 184.19 g/mol. IUPAC name: spiro[3.3]heptane-2,6-dicarboxylic acid. InChIKey: JQZAKMJZYGPUFD-UHFFFAOYSA-N.
| Molecular formula | C9H12O4 |
|---|---|
| Molecular weight | 184.19 g/mol |
| IUPAC name | spiro[3.3]heptane-2,6-dicarboxylic acid |
| InChIKey | JQZAKMJZYGPUFD-UHFFFAOYSA-N |
| SMILES | C1C(CC12CC(C2)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)