CAS 31139-03-4 appears in our catalog under these names: 4-Cyclohexene-1,2-dicarboxylic acid, 1-methyl ester, (1r,2r)-rel-, 95%, (1R,6R)-6-(Methoxycarbonyl)cyclohex-3-enecarboxylic acid, 98%, 98%, 4-CYCLOHEXENE-1,2-DICARBOXYLIC ACID, 1-METHYL ESTER, (1R,2R)-REL-, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 250mg, 1g, 100mg.
(1R,6R)-6-methoxycarbonylcyclohex-3-ene-1-carboxylic acid (CAS 31139-03-4) is a chemical compound with the molecular formula C9H12O4 and a molecular weight of 184.19 g/mol. IUPAC name: (1R,6R)-6-methoxycarbonylcyclohex-3-ene-1-carboxylic acid. InChIKey: MYYLMIDEMAPSGH-RNFRBKRXSA-N.
| Molecular formula | C9H12O4 |
|---|---|
| Molecular weight | 184.19 g/mol |
| IUPAC name | (1R,6R)-6-methoxycarbonylcyclohex-3-ene-1-carboxylic acid |
| InChIKey | MYYLMIDEMAPSGH-RNFRBKRXSA-N |
| SMILES | COC(=O)[C@@H]1CC=CC[C@H]1C(=O)O |
Computed by PubChem (NCBI)