Products 2361972-29-2
CAS 2361972-29-2 appears in our catalog under these names: Succinate/succinate receptor antagonist 1, Succinate/succinate receptor antagonist 1, Succinate/succinate receptor antagonist 1, 99.40%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 10mM * 1mlindmso.
N-methyl-2-[4-(1,8-naphthyridin-2-yl)phenyl]acetamide (CAS 2361972-29-2) is a chemical compound with the molecular formula C17H15N3O and a molecular weight of 277.32 g/mol. IUPAC name: N-methyl-2-[4-(1,8-naphthyridin-2-yl)phenyl]acetamide. InChIKey: CNTLNLSLKYIFRS-UHFFFAOYSA-N.
| Molecular formula | C17H15N3O |
|---|---|
| Molecular weight | 277.32 g/mol |
| IUPAC name | N-methyl-2-[4-(1,8-naphthyridin-2-yl)phenyl]acetamide |
| InChIKey | CNTLNLSLKYIFRS-UHFFFAOYSA-N |
| SMILES | CNC(=O)CC1=CC=C(C=C1)C2=NC3=C(C=CC=N3)C=C2 |
Computed by PubChem (NCBI)