cas: 2173637-27-7 — see every product listed under this CAS number, including other names
TERT-BUTYL (3R,4S)-4-METHYLPYRROLIDIN-3-YLCARBAMATE HYDROCHLORIDE, 97% (CAS 2173637-27-7) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F535114-50MG |
| cas | 2173637-27-7 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 409.25 Pln | |
| Fluorochem | 100mg | 591.48 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl N-[(3R,4S)-4-methylpyrrolidin-3-yl]carbamate;hydrochloride (CAS 2173637-27-7) is a chemical compound with the molecular formula C10H21ClN2O2 and a molecular weight of 236.74 g/mol. IUPAC name: tert-butyl N-[(3R,4S)-4-methylpyrrolidin-3-yl]carbamate;hydrochloride. InChIKey: RZXBZGWTVRXEHJ-WSZWBAFRSA-N.
| Molecular formula | C10H21ClN2O2 |
|---|---|
| Molecular weight | 236.74 g/mol |
| IUPAC name | tert-butyl N-[(3R,4S)-4-methylpyrrolidin-3-yl]carbamate;hydrochloride |
| InChIKey | RZXBZGWTVRXEHJ-WSZWBAFRSA-N |
| SMILES | C[C@H]1CNC[C@@H]1NC(=O)OC(C)(C)C.Cl |
Computed by PubChem (NCBI)