Products 2097068-61-4

CAS 2097068-61-4 is the registry number for trans-(4-Methyl-pyrrolidin-3-yl)-carbamic acid tert-butyl ester hydrochloride, 97%. Offered by: AmBeed. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

Tert-butyl N-[(3R,4S)-4-methylpyrrolidin-3-yl]carbamate;hydrochloride (CAS 2097068-61-4) is a chemical compound with the molecular formula C10H21ClN2O2 and a molecular weight of 236.74 g/mol. IUPAC name: tert-butyl N-[(3R,4S)-4-methylpyrrolidin-3-yl]carbamate;hydrochloride. InChIKey: RZXBZGWTVRXEHJ-WSZWBAFRSA-N.

Identity
Molecular formulaC10H21ClN2O2
Molecular weight236.74 g/mol
IUPAC nametert-butyl N-[(3R,4S)-4-methylpyrrolidin-3-yl]carbamate;hydrochloride
InChIKeyRZXBZGWTVRXEHJ-WSZWBAFRSA-N
SMILESC[C@H]1CNC[C@@H]1NC(=O)OC(C)(C)C.Cl

Computed by PubChem (NCBI)