CAS 2097068-61-4 is the registry number for trans-(4-Methyl-pyrrolidin-3-yl)-carbamic acid tert-butyl ester hydrochloride, 97%. Offered by: AmBeed. Available pack sizes: 1g.
Tert-butyl N-[(3R,4S)-4-methylpyrrolidin-3-yl]carbamate;hydrochloride (CAS 2097068-61-4) is a chemical compound with the molecular formula C10H21ClN2O2 and a molecular weight of 236.74 g/mol. IUPAC name: tert-butyl N-[(3R,4S)-4-methylpyrrolidin-3-yl]carbamate;hydrochloride. InChIKey: RZXBZGWTVRXEHJ-WSZWBAFRSA-N.
| Molecular formula | C10H21ClN2O2 |
|---|---|
| Molecular weight | 236.74 g/mol |
| IUPAC name | tert-butyl N-[(3R,4S)-4-methylpyrrolidin-3-yl]carbamate;hydrochloride |
| InChIKey | RZXBZGWTVRXEHJ-WSZWBAFRSA-N |
| SMILES | C[C@H]1CNC[C@@H]1NC(=O)OC(C)(C)C.Cl |
Computed by PubChem (NCBI)