CAS 2173637-29-9 appears in our catalog under these names: Carbamic acid, N-[(3S,4R)-4-methyl-3-pyrrolidinyl]-, 1,1-dimethylethyl ester, hydrochloride (1:1), 97%, 97%, tert-Butyl (3S,4R)-4-methylpyrrolidin-3-ylcarbamate hydrochloride, 97%, tert-Butyl (3S,4R)-4-methylpyrrolidin-3-ylcarbamate hydrochloride, 98%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g.
Tert-butyl N-[(3S,4R)-4-methylpyrrolidin-3-yl]carbamate;hydrochloride (CAS 2173637-29-9) is a chemical compound with the molecular formula C10H21ClN2O2 and a molecular weight of 236.74 g/mol. IUPAC name: tert-butyl N-[(3S,4R)-4-methylpyrrolidin-3-yl]carbamate;hydrochloride. InChIKey: RZXBZGWTVRXEHJ-SCLLHFNJSA-N.
| Molecular formula | C10H21ClN2O2 |
|---|---|
| Molecular weight | 236.74 g/mol |
| IUPAC name | tert-butyl N-[(3S,4R)-4-methylpyrrolidin-3-yl]carbamate;hydrochloride |
| InChIKey | RZXBZGWTVRXEHJ-SCLLHFNJSA-N |
| SMILES | C[C@@H]1CNC[C@H]1NC(=O)OC(C)(C)C.Cl |
Computed by PubChem (NCBI)