cas: 1158767-01-1 — see every product listed under this CAS number, including other names
TERT-BUTYL (4,5,6,7-TETRAHYDRO-1H-INDAZOL-5-YL)CARBAMATE, 97% (CAS 1158767-01-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F500833-100MG |
| cas | 1158767-01-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 159.34 Pln | |
| Fluorochem | 250mg | 216.61 Pln | |
| Fluorochem | 1g | 685.19 Pln | |
| Fluorochem | 5g | 3184.31 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl N-(4,5,6,7-tetrahydro-1H-indazol-5-yl)carbamate (CAS 1158767-01-1) is a chemical compound with the molecular formula C12H19N3O2 and a molecular weight of 237.30 g/mol. IUPAC name: tert-butyl N-(4,5,6,7-tetrahydro-1H-indazol-5-yl)carbamate. InChIKey: PMIXNXQUMXCCIK-UHFFFAOYSA-N.
| Molecular formula | C12H19N3O2 |
|---|---|
| Molecular weight | 237.30 g/mol |
| IUPAC name | tert-butyl N-(4,5,6,7-tetrahydro-1H-indazol-5-yl)carbamate |
| InChIKey | PMIXNXQUMXCCIK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1CCC2=C(C1)C=NN2 |
Computed by PubChem (NCBI)