tert-Butyl 2,3,4,5,6-pentafluorobenzoate, 97%
cas: 98040-93-8 — see every product listed under this CAS number, including other names
tert-Butyl 2,3,4,5,6-pentafluorobenzoate, 97% (CAS 98040-93-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1504258-100mg |
| cas | 98040-93-8 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 153.44 Pln | |
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 303.62 Pln | |
| Ambeed | 5g | 1021.19 Pln | |
| Ambeed | 10g | 1861.13 Pln | |
| Chemat | 100mg | 122.00 Pln | |
| Chemat | 250mg | 160.40 Pln | |
| Chemat | 1g | 328.40 Pln | |
| Chemat | 5g | 1173.20 Pln | |
| BLDpharm | 100mg | 136.64 Pln | |
| BLDpharm | 250mg | 186.63 Pln | |
| BLDpharm | 1g | 319.91 Pln | |
| BLDpharm | 5g | 1097.42 Pln | |
| BLDpharm | 10g | 1997.10 Pln | |
| Fluorochem | 100mg | 200.99 Pln | |
| Fluorochem | 250mg | 268.67 Pln | |
| Fluorochem | 1g | 591.48 Pln | |
| Fluorochem | 5g | 2174.25 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
Tert-butyl 2,3,4,5,6-pentafluorobenzoate (CAS 98040-93-8) is a chemical compound with the molecular formula C11H9F5O2 and a molecular weight of 268.18 g/mol. IUPAC name: tert-butyl 2,3,4,5,6-pentafluorobenzoate. InChIKey: MWMSVYICOCCEKL-UHFFFAOYSA-N.
| Molecular formula | C11H9F5O2 |
|---|---|
| Molecular weight | 268.18 g/mol |
| IUPAC name | tert-butyl 2,3,4,5,6-pentafluorobenzoate |
| InChIKey | MWMSVYICOCCEKL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=C(C(=C(C(=C1F)F)F)F)F |
Computed by PubChem (NCBI)