Products 2921894-76-8
CAS 2921894-76-8 is the registry number for 1-(2,4-difluoro-3-isopropoxyphenyl)-2,2,2-trifluoroethanone, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(2,4-difluoro-3-propan-2-yloxyphenyl)-2,2,2-trifluoroethanone (CAS 2921894-76-8) is a chemical compound with the molecular formula C11H9F5O2 and a molecular weight of 268.18 g/mol. IUPAC name: 1-(2,4-difluoro-3-propan-2-yloxyphenyl)-2,2,2-trifluoroethanone. InChIKey: VXPRJKWCIYVWOF-UHFFFAOYSA-N.
| Molecular formula | C11H9F5O2 |
|---|---|
| Molecular weight | 268.18 g/mol |
| IUPAC name | 1-(2,4-difluoro-3-propan-2-yloxyphenyl)-2,2,2-trifluoroethanone |
| InChIKey | VXPRJKWCIYVWOF-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C=CC(=C1F)C(=O)C(F)(F)F)F |
Computed by PubChem (NCBI)