CAS 1427011-75-3 is the registry number for 2-(3,3,4,4,4-Pentafluorobutoxy)benzaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(3,3,4,4,4-pentafluorobutoxy)benzaldehyde (CAS 1427011-75-3) is a chemical compound with the molecular formula C11H9F5O2 and a molecular weight of 268.18 g/mol. IUPAC name: 2-(3,3,4,4,4-pentafluorobutoxy)benzaldehyde. InChIKey: JSMDCBPQEZBHMY-UHFFFAOYSA-N.
| Molecular formula | C11H9F5O2 |
|---|---|
| Molecular weight | 268.18 g/mol |
| IUPAC name | 2-(3,3,4,4,4-pentafluorobutoxy)benzaldehyde |
| InChIKey | JSMDCBPQEZBHMY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C=O)OCCC(C(F)(F)F)(F)F |
Computed by PubChem (NCBI)