CAS 98040-93-8 appears in our catalog under these names: tert-Butyl 2,3,4,5,6-pentafluorobenzoate, 97%, 97%, TERT-BUTYL 2,3,4,5,6-PENTAFLUOROBENZOATE, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
Tert-butyl 2,3,4,5,6-pentafluorobenzoate (CAS 98040-93-8) is a chemical compound with the molecular formula C11H9F5O2 and a molecular weight of 268.18 g/mol. IUPAC name: tert-butyl 2,3,4,5,6-pentafluorobenzoate. InChIKey: MWMSVYICOCCEKL-UHFFFAOYSA-N.
| Molecular formula | C11H9F5O2 |
|---|---|
| Molecular weight | 268.18 g/mol |
| IUPAC name | tert-butyl 2,3,4,5,6-pentafluorobenzoate |
| InChIKey | MWMSVYICOCCEKL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=C(C(=C(C(=C1F)F)F)F)F |
Computed by PubChem (NCBI)