Products 175543-24-5
CAS 175543-24-5 appears in our catalog under these names: ethyl 2，2–difluoro–2–(3–(trifluoromethyl)phenyl)acetate, Ethyl 2,2-difluoro-2-(3-(trifluoromethyl)phenyl)acetate. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 250mg, 5g.
Ethyl 2,2-difluoro-2-[3-(trifluoromethyl)phenyl]acetate (CAS 175543-24-5) is a chemical compound with the molecular formula C11H9F5O2 and a molecular weight of 268.18 g/mol. IUPAC name: ethyl 2,2-difluoro-2-[3-(trifluoromethyl)phenyl]acetate. InChIKey: OZHYEXJBDXMHPC-UHFFFAOYSA-N.
| Molecular formula | C11H9F5O2 |
|---|---|
| Molecular weight | 268.18 g/mol |
| IUPAC name | ethyl 2,2-difluoro-2-[3-(trifluoromethyl)phenyl]acetate |
| InChIKey | OZHYEXJBDXMHPC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C1=CC(=CC=C1)C(F)(F)F)(F)F |
Computed by PubChem (NCBI)