cas: 1029720-19-1 — see every product listed under this CAS number, including other names
TERT-BUTYL 3,3-DIFLUOROCYCLOBUTYLCARBAMATE (CAS 1029720-19-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F501946-250MG |
| cas | 1029720-19-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 164.54 Pln | |
| Fluorochem | 1g | 383.22 Pln | |
| Fluorochem | 5g | 1002.79 Pln | |
| Fluorochem | 10g | 1611.95 Pln | |
| Fluorochem | 25g | 3153.07 Pln |
| delivery time | 3-4 weeks |
|---|
Tert-butyl N-(3,3-difluorocyclobutyl)carbamate (CAS 1029720-19-1) is a chemical compound with the molecular formula C9H15F2NO2 and a molecular weight of 207.22 g/mol. IUPAC name: tert-butyl N-(3,3-difluorocyclobutyl)carbamate. InChIKey: AYWSUTXVTWBHLF-UHFFFAOYSA-N.
| Molecular formula | C9H15F2NO2 |
|---|---|
| Molecular weight | 207.22 g/mol |
| IUPAC name | tert-butyl N-(3,3-difluorocyclobutyl)carbamate |
| InChIKey | AYWSUTXVTWBHLF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1CC(C1)(F)F |
Computed by PubChem (NCBI)