Products 1892376-26-9

CAS 1892376-26-9 is the registry number for 3-(4,4-Difluoro-piperidin-1-yl)-propionic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

Methyl 3-(4,4-difluoropiperidin-1-yl)propanoate (CAS 1892376-26-9) is a chemical compound with the molecular formula C9H15F2NO2 and a molecular weight of 207.22 g/mol. IUPAC name: methyl 3-(4,4-difluoropiperidin-1-yl)propanoate. InChIKey: AQAKTAJVIMBSIR-UHFFFAOYSA-N.

Identity
Molecular formulaC9H15F2NO2
Molecular weight207.22 g/mol
IUPAC namemethyl 3-(4,4-difluoropiperidin-1-yl)propanoate
InChIKeyAQAKTAJVIMBSIR-UHFFFAOYSA-N
SMILESCOC(=O)CCN1CCC(CC1)(F)F

Computed by PubChem (NCBI)