cas: 1029720-19-1 — see every product listed under this CAS number, including other names
tert-Butyl (3,3-difluorocyclobutyl)carbamate, 98%, 98% (CAS 1029720-19-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 5g, 25g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119XJS-100mg |
| cas | 1029720-19-1 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 208.40 Pln | |
| Chemat | 1g | 246.80 Pln | |
| Chemat | 5g | 621.20 Pln | |
| Chemat | 25g | 1917.20 Pln | |
| Chemat | 10g | 990.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-(3,3-difluorocyclobutyl)carbamate (CAS 1029720-19-1) is a chemical compound with the molecular formula C9H15F2NO2 and a molecular weight of 207.22 g/mol. IUPAC name: tert-butyl N-(3,3-difluorocyclobutyl)carbamate. InChIKey: AYWSUTXVTWBHLF-UHFFFAOYSA-N.
| Molecular formula | C9H15F2NO2 |
|---|---|
| Molecular weight | 207.22 g/mol |
| IUPAC name | tert-butyl N-(3,3-difluorocyclobutyl)carbamate |
| InChIKey | AYWSUTXVTWBHLF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1CC(C1)(F)F |
Computed by PubChem (NCBI)