CAS 2306249-99-8 is the registry number for Ethyl (1S,2S)-2-amino-5,5-difluorocyclohexane-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Trans-ethyl (1S,2S)-2-amino-5,5-difluorocyclohexane-1-carboxylate (CAS 2306249-99-8) is a chemical compound with the molecular formula C9H15F2NO2 and a molecular weight of 207.22 g/mol. IUPAC name: trans-ethyl (1S,2S)-2-amino-5,5-difluorocyclohexane-1-carboxylate. InChIKey: ZZKFYDPVAOEOIV-BQBZGAKWSA-N.
| Molecular formula | C9H15F2NO2 |
|---|---|
| Molecular weight | 207.22 g/mol |
| IUPAC name | trans-ethyl (1S,2S)-2-amino-5,5-difluorocyclohexane-1-carboxylate |
| InChIKey | ZZKFYDPVAOEOIV-BQBZGAKWSA-N |
| SMILES | CCOC(=O)[C@H]1CC(CC[C@@H]1N)(F)F |
Computed by PubChem (NCBI)