CAS 195447-25-7 appears in our catalog under these names: 1-Boc-3,3-difluoropyrrolidine, 96%, 1-Boc-3,3-difluoropyrrolidine, 97%, 97%, tert-Butyl 3,3-difluoropyrrolidine-1-carboxylate, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 25g, 1g, 250mg.
Tert-butyl 3,3-difluoropyrrolidine-1-carboxylate (CAS 195447-25-7) is a chemical compound with the molecular formula C9H15F2NO2 and a molecular weight of 207.22 g/mol. IUPAC name: tert-butyl 3,3-difluoropyrrolidine-1-carboxylate. InChIKey: ULFWNKDACVUZOD-UHFFFAOYSA-N.
| Molecular formula | C9H15F2NO2 |
|---|---|
| Molecular weight | 207.22 g/mol |
| IUPAC name | tert-butyl 3,3-difluoropyrrolidine-1-carboxylate |
| InChIKey | ULFWNKDACVUZOD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(C1)(F)F |
Computed by PubChem (NCBI)