cas: 1394003-66-7 — see every product listed under this CAS number, including other names
TERT-BUTYL PYRAZOLO[1,5-A]PYRIMIDIN-3-YLCARBAMATE,, 98% (CAS 1394003-66-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F305742-100MG |
| cas | 1394003-66-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 128.10 Pln | |
| Fluorochem | 250mg | 206.20 Pln | |
| Fluorochem | 1g | 456.11 Pln | |
| Fluorochem | 5g | 1611.95 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl N-pyrazolo[1,5-a]pyrimidin-3-ylcarbamate (CAS 1394003-66-7) is a chemical compound with the molecular formula C11H14N4O2 and a molecular weight of 234.25 g/mol. IUPAC name: tert-butyl N-pyrazolo[1,5-a]pyrimidin-3-ylcarbamate. InChIKey: XEEBWARTSKGTSY-UHFFFAOYSA-N.
| Molecular formula | C11H14N4O2 |
|---|---|
| Molecular weight | 234.25 g/mol |
| IUPAC name | tert-butyl N-pyrazolo[1,5-a]pyrimidin-3-ylcarbamate |
| InChIKey | XEEBWARTSKGTSY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C2N=CC=CN2N=C1 |
Computed by PubChem (NCBI)