cas: 2054199-25-4 — see every product listed under this CAS number, including other names
TNF-α-IN-9 (CAS 2054199-25-4) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 5 mg, 50 mg. Offered by: Chemat, MedChemExpress.
| brand | Chemat |
|---|---|
| catalog number | Ch13CAY9-1mg |
| cas | 2054199-25-4 |
| size | 1mg |
| availability | 0.1g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1mg | 251.60 Pln | |
| Chemat | 5mg | 496.40 Pln | |
| Chemat | 10mg | 702.80 Pln | |
| Chemat | 25mg | 1154.00 Pln | |
| Chemat | 50mg | 1672.40 Pln | |
| Chemat | 100mg | 2373.20 Pln | |
| MedChemExpress | 5 mg | 1531.78 Pln | |
| MedChemExpress | 50 mg | 5307.35 Pln | |
| MedChemExpress | 1 mg | 756.23 Pln | |
| MedChemExpress | 25 mg | 3640.15 Pln | |
| MedChemExpress | 10 mg | 2191.22 Pln |
| delivery time | 3 weeks |
|---|
(2E)-7-hydroxy-2-[(3-hydroxy-4-methoxyphenyl)methylidene]-3H-inden-1-one (CAS 2054199-25-4) is a chemical compound with the molecular formula C17H14O4 and a molecular weight of 282.29 g/mol. IUPAC name: (2E)-7-hydroxy-2-[(3-hydroxy-4-methoxyphenyl)methylidene]-3H-inden-1-one. InChIKey: DTYRWCZQDOSZHB-KPKJPENVSA-N.
| Molecular formula | C17H14O4 |
|---|---|
| Molecular weight | 282.29 g/mol |
| IUPAC name | (2E)-7-hydroxy-2-[(3-hydroxy-4-methoxyphenyl)methylidene]-3H-inden-1-one |
| InChIKey | DTYRWCZQDOSZHB-KPKJPENVSA-N |
| SMILES | COC1=C(C=C(C=C1)/C=C/2\CC3=C(C2=O)C(=CC=C3)O)O |
Computed by PubChem (NCBI)