CAS 2054199-25-4 appears in our catalog under these names: TNF-α-IN-9, 98%, TNF-α-IN-9/ 98.28% (existing batch purity), TNF-α-IN-9. Offered by: AmBeed, TargetMol, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 1mg, 25mg, 50mg, 100mg, 500mg, 5 mg.
(2E)-7-hydroxy-2-[(3-hydroxy-4-methoxyphenyl)methylidene]-3H-inden-1-one (CAS 2054199-25-4) is a chemical compound with the molecular formula C17H14O4 and a molecular weight of 282.29 g/mol. IUPAC name: (2E)-7-hydroxy-2-[(3-hydroxy-4-methoxyphenyl)methylidene]-3H-inden-1-one. InChIKey: DTYRWCZQDOSZHB-KPKJPENVSA-N.
| Molecular formula | C17H14O4 |
|---|---|
| Molecular weight | 282.29 g/mol |
| IUPAC name | (2E)-7-hydroxy-2-[(3-hydroxy-4-methoxyphenyl)methylidene]-3H-inden-1-one |
| InChIKey | DTYRWCZQDOSZHB-KPKJPENVSA-N |
| SMILES | COC1=C(C=C(C=C1)/C=C/2\CC3=C(C2=O)C(=CC=C3)O)O |
Computed by PubChem (NCBI)