Products 79756-69-7
CAS 79756-69-7 appears in our catalog under these names: TPI-1/ 99.79% (existing batch purity), TPI–1, TPI-1 98%, 2',5'-Dichloro-[1,1'-biphenyl]-2,5-dione, 98%, 98%, TPI-1, 98.0%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg.
2-(2,5-dichlorophenyl)cyclohexa-2,5-diene-1,4-dione (CAS 79756-69-7) is a chemical compound with the molecular formula C12H6Cl2O2 and a molecular weight of 253.08 g/mol. IUPAC name: 2-(2,5-dichlorophenyl)cyclohexa-2,5-diene-1,4-dione. InChIKey: ZKHFYORNAYYOTM-UHFFFAOYSA-N.
| Molecular formula | C12H6Cl2O2 |
|---|---|
| Molecular weight | 253.08 g/mol |
| IUPAC name | 2-(2,5-dichlorophenyl)cyclohexa-2,5-diene-1,4-dione |
| InChIKey | ZKHFYORNAYYOTM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C2=CC(=O)C=CC2=O)Cl |
Computed by PubChem (NCBI)
Synonyms:
2-(2,5-Dichlorophenyl)-1,4-benzoquinone, tpi-1, 2-(2,5-dichlorophenyl)cyclohexa-2,5-diene-1,4-dione, 2',5'-Dichloro-[1,1'-biphenyl]-2,5-dione, 2,5-Cyclohexadiene-1,4-dione, 2-(2,5-dichlorophenyl)-, 2-(2,5-dichlorophenyl)-2,5-cyclohexadiene-1,4-dione, CBMicro_042121, orb1223049, orb1303509, Tyrosine Phosphatase Inhibitor 1