cas: 401811-97-0 — see every product listed under this CAS number, including other names
Tert-Butyl 4-(2-Ethoxy-2-Oxoethyl)-4-Hydroxypiperidine-1-Carboxylate, 98%, 98% (CAS 401811-97-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CL94-100mg |
| cas | 401811-97-0 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 227.60 Pln | |
| Chemat | 250mg | 328.40 Pln | |
| Chemat | 500mg | 563.60 Pln | |
| Chemat | 1g | 750.80 Pln | |
| Chemat | 5g | 2469.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 4-(2-ethoxy-2-oxoethyl)-4-hydroxypiperidine-1-carboxylate (CAS 401811-97-0) is a chemical compound with the molecular formula C14H25NO5 and a molecular weight of 287.35 g/mol. IUPAC name: tert-butyl 4-(2-ethoxy-2-oxoethyl)-4-hydroxypiperidine-1-carboxylate. InChIKey: YADZDGIBSUOHJU-UHFFFAOYSA-N.
| Molecular formula | C14H25NO5 |
|---|---|
| Molecular weight | 287.35 g/mol |
| IUPAC name | tert-butyl 4-(2-ethoxy-2-oxoethyl)-4-hydroxypiperidine-1-carboxylate |
| InChIKey | YADZDGIBSUOHJU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1(CCN(CC1)C(=O)OC(C)(C)C)O |
Computed by PubChem (NCBI)