cas: 401811-97-0 — see every product listed under this CAS number, including other names
tert-Butyl 4-(2-ethoxy-2-oxoethyl)-4-hydroxypiperidine-1-carboxylate 98% (CAS 401811-97-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A586315-100mg |
| cas | 401811-97-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 325.88 Pln | |
| Ambeed | 250mg | 464.94 Pln | |
| Ambeed | 1g | 1115.75 Pln | |
| Ambeed | 5g | 3813.56 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A586315 |
Tert-butyl 4-(2-ethoxy-2-oxoethyl)-4-hydroxypiperidine-1-carboxylate (CAS 401811-97-0) is a chemical compound with the molecular formula C14H25NO5 and a molecular weight of 287.35 g/mol. IUPAC name: tert-butyl 4-(2-ethoxy-2-oxoethyl)-4-hydroxypiperidine-1-carboxylate. InChIKey: YADZDGIBSUOHJU-UHFFFAOYSA-N.
| Molecular formula | C14H25NO5 |
|---|---|
| Molecular weight | 287.35 g/mol |
| IUPAC name | tert-butyl 4-(2-ethoxy-2-oxoethyl)-4-hydroxypiperidine-1-carboxylate |
| InChIKey | YADZDGIBSUOHJU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1(CCN(CC1)C(=O)OC(C)(C)C)O |
Computed by PubChem (NCBI)