cas: 1354356-24-3 — see every product listed under this CAS number, including other names
Tert-Butyl 5-(4,4,5,5-Tetramethyl-1,3,2-Dioxaborolan-2-Yl)Picolinate, 95%, 95% (CAS 1354356-24-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HU69-100mg |
| cas | 1354356-24-3 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 107.60 Pln | |
| Chemat | 250mg | 155.60 Pln | |
| Chemat | 10g | 4254.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carboxylate (CAS 1354356-24-3) is a chemical compound with the molecular formula C16H24BNO4 and a molecular weight of 305.2 g/mol. IUPAC name: tert-butyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carboxylate. InChIKey: IALBJISWTZHHAJ-UHFFFAOYSA-N.
| Molecular formula | C16H24BNO4 |
|---|---|
| Molecular weight | 305.2 g/mol |
| IUPAC name | tert-butyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carboxylate |
| InChIKey | IALBJISWTZHHAJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(C=C2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)