cas: 5330-63-2 — see every product listed under this CAS number, including other names
Tert-butyl (3-chlorophenyl)carbamate, 98% (CAS 5330-63-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F624161-5G |
| cas | 5330-63-2 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 289.50 Pln | |
| Fluorochem | 10g | 456.11 Pln | |
| Fluorochem | 25g | 732.05 Pln | |
| Fluorochem | 100g | 2580.36 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl N-(3-chlorophenyl)carbamate (CAS 5330-63-2) is a chemical compound with the molecular formula C11H14ClNO2 and a molecular weight of 227.69 g/mol. IUPAC name: tert-butyl N-(3-chlorophenyl)carbamate. InChIKey: NHKRPSNCGCLFHJ-UHFFFAOYSA-N.
| Molecular formula | C11H14ClNO2 |
|---|---|
| Molecular weight | 227.69 g/mol |
| IUPAC name | tert-butyl N-(3-chlorophenyl)carbamate |
| InChIKey | NHKRPSNCGCLFHJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC(=CC=C1)Cl |
Computed by PubChem (NCBI)