Tert-butyl (3-chlorophenyl)carbamate, 98%
cas: 5330-63-2 — see every product listed under this CAS number, including other names
Tert-butyl (3-chlorophenyl)carbamate, 98% (CAS 5330-63-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 250mg, 1g. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F624161-5G |
| cas | 5330-63-2 |
| size | 5g |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 305.12 Pln | |
| Fluorochem | 10g | 482.14 Pln | |
| Fluorochem | 25g | 768.50 Pln | |
| Fluorochem | 100g | 2694.90 Pln | |
| Ambeed | 5g | 309.19 Pln | |
| Ambeed | 25g | 759.75 Pln | |
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 102.80 Pln | |
| Chemat | 5g | 213.20 Pln | |
| Chemat | 10g | 309.20 Pln | |
| Chemat | 25g | 602.00 Pln | |
| BLDpharm | 5g | 325.47 Pln | |
| BLDpharm | 10g | 575.38 Pln | |
| BLDpharm | 25g | 814.18 Pln | |
| BLDpharm | 100g | 3030.07 Pln |
properties
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
Tert-butyl N-(3-chlorophenyl)carbamate (CAS 5330-63-2) is a chemical compound with the molecular formula C11H14ClNO2 and a molecular weight of 227.69 g/mol. IUPAC name: tert-butyl N-(3-chlorophenyl)carbamate. InChIKey: NHKRPSNCGCLFHJ-UHFFFAOYSA-N.
| Molecular formula | C11H14ClNO2 |
|---|---|
| Molecular weight | 227.69 g/mol |
| IUPAC name | tert-butyl N-(3-chlorophenyl)carbamate |
| InChIKey | NHKRPSNCGCLFHJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC(=CC=C1)Cl |
Computed by PubChem (NCBI)