CAS 1380500-92-4 appears in our catalog under these names: 2-[4-(1,2,4,5-Tetrazin-3-yl)phenyl]acetic acid, 95%, Tetrazine-Ph-acid, Tetrazine–Ph–acid, 2-(4-(1,2,4,5-Tetrazin-3-Yl)Phenyl)Acetic Acid, 98%, 98%, Tetrazine-Ph-acid, 98.79%. Offered by: Combi-blocks, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1g, 100mg, 2mg, 25mg, 50mg, 250mg, 50 mg, 25 mg.
2-[4-(1,2,4,5-tetrazin-3-yl)phenyl]acetic acid (CAS 1380500-92-4) is a chemical compound with the molecular formula C10H8N4O2 and a molecular weight of 216.20 g/mol. IUPAC name: 2-[4-(1,2,4,5-tetrazin-3-yl)phenyl]acetic acid. InChIKey: SLJKKTFIAUAYGR-UHFFFAOYSA-N.
| Molecular formula | C10H8N4O2 |
|---|---|
| Molecular weight | 216.20 g/mol |
| IUPAC name | 2-[4-(1,2,4,5-tetrazin-3-yl)phenyl]acetic acid |
| InChIKey | SLJKKTFIAUAYGR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC(=O)O)C2=NN=CN=N2 |
Computed by PubChem (NCBI)