cas: 949922-62-7 — see every product listed under this CAS number, including other names
Thieno[3,2-c]pyridine-5(4H)-carboxylic acid, 2-bromo-6,7-dihydro-, 1,1-dimethylethyl ester, 95% (stabilized with Cu+HQ+MgO), 95% (stabilized with Cu+HQ+MgO) (CAS 949922-62-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch117QF8-100mg |
| cas | 949922-62-7 |
| size | 100mg |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 250mg | 126.80 Pln | |
| Chemat | 1g | 198.80 Pln | |
| Chemat | 5g | 746.00 Pln | |
| Chemat | 10g | 1192.40 Pln | |
| Chemat | 25g | 2430.80 Pln |
| purity | 95% (stabilized with Cu+HQ+MgO) |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 2-bromo-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carboxylate (CAS 949922-62-7) is a chemical compound with the molecular formula C12H16BrNO2S and a molecular weight of 318.23 g/mol. IUPAC name: tert-butyl 2-bromo-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carboxylate. InChIKey: ALVKHVFHUNINLV-UHFFFAOYSA-N.
| Molecular formula | C12H16BrNO2S |
|---|---|
| Molecular weight | 318.23 g/mol |
| IUPAC name | tert-butyl 2-bromo-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carboxylate |
| InChIKey | ALVKHVFHUNINLV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=C(C1)C=C(S2)Br |
Computed by PubChem (NCBI)