cas: 949922-62-7 — see every product listed under this CAS number, including other names
tert-Butyl 2-bromo-6,7-dihydrothieno[3,2-c]pyridine-5(4H)-carboxylate 95% (stabilized with Cu+HQ+MgO) (CAS 949922-62-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A206027-100mg |
| cas | 949922-62-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 159.00 Pln | |
| Ambeed | 250mg | 181.25 Pln | |
| Ambeed | 1g | 292.50 Pln | |
| Ambeed | 5g | 926.62 Pln | |
| Ambeed | 25g | 3374.12 Pln |
| purity | 95% (stabilized with Cu+HQ+MgO) |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A206027 |
Tert-butyl 2-bromo-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carboxylate (CAS 949922-62-7) is a chemical compound with the molecular formula C12H16BrNO2S and a molecular weight of 318.23 g/mol. IUPAC name: tert-butyl 2-bromo-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carboxylate. InChIKey: ALVKHVFHUNINLV-UHFFFAOYSA-N.
| Molecular formula | C12H16BrNO2S |
|---|---|
| Molecular weight | 318.23 g/mol |
| IUPAC name | tert-butyl 2-bromo-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carboxylate |
| InChIKey | ALVKHVFHUNINLV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=C(C1)C=C(S2)Br |
Computed by PubChem (NCBI)