cas: 58880-19-6 — see every product listed under this CAS number, including other names
Trichostatin A 98% (CAS 58880-19-6) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A725112-1mg |
| cas | 58880-19-6 |
| size | 1mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 565.06 Pln | |
| Ambeed | 2mg | 665.19 Pln | |
| Ambeed | 5mg | 1182.50 Pln | |
| Ambeed | 10mg | 1877.81 Pln | |
| Ambeed | 25mg | 3685.62 Pln | |
| Ambeed | 50mg | 5843.88 Pln | |
| Ambeed | 100mg | 9309.31 Pln | |
| Ambeed | 250mg | 18548.62 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A725112 |
Trichostatin A is a hydroxamic acid, a trichostatin and an antibiotic antifungal agent. It has a role as a geroprotector, an EC 3.5.1.98 (histone deacetylase) inhibitor and a bacterial metabolite. It is functionally related to a (R)-trichostatic acid.
Source: ChEBI
| Molecular formula | C17H22N2O3 |
|---|---|
| Molecular weight | 302.37 g/mol |
| IUPAC name | (2E,4E,6R)-7-[4-(dimethylamino)phenyl]-N-hydroxy-4,6-dimethyl-7-oxohepta-2,4-dienamide |
| InChIKey | RTKIYFITIVXBLE-QEQCGCAPSA-N |
| SMILES | C[C@H](/C=C(\C)/C=C/C(=O)NO)C(=O)C1=CC=C(C=C1)N(C)C |
Computed by PubChem (NCBI)