Triethyl benzene-1,3,5-tricarboxylate, 98%
cas: 4105-92-4 — see every product listed under this CAS number, including other names
Triethyl benzene-1,3,5-tricarboxylate, 98% (CAS 4105-92-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 1g, 10g. Offered by: Ambeed, Chemat, Fluorochem, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A222140-5g |
| cas | 4105-92-4 |
| size | 5g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 231.31 Pln | |
| Ambeed | 25g | 626.25 Pln | |
| Ambeed | 100g | 2289.44 Pln | |
| Chemat | 1g | 93.20 Pln | |
| Chemat | 5g | 189.20 Pln | |
| Chemat | 10g | 314.00 Pln | |
| Chemat | 25g | 467.60 Pln | |
| Chemat | 100g | 1677.20 Pln | |
| Fluorochem | 1g | 133.30 Pln | |
| Fluorochem | 5g | 227.02 Pln | |
| Fluorochem | 10g | 388.42 Pln | |
| Fluorochem | 25g | 622.72 Pln | |
| Fluorochem | 100g | 2288.80 Pln | |
| BLDpharm | 5g | 247.72 Pln | |
| BLDpharm | 25g | 669.79 Pln | |
| BLDpharm | 100g | 2458.05 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
Triethyl benzene-1,3,5-tricarboxylate (CAS 4105-92-4) is a chemical compound with the molecular formula C15H18O6 and a molecular weight of 294.30 g/mol. IUPAC name: triethyl benzene-1,3,5-tricarboxylate. InChIKey: KXGOWZRHSOJOLF-UHFFFAOYSA-N.
| Molecular formula | C15H18O6 |
|---|---|
| Molecular weight | 294.30 g/mol |
| IUPAC name | triethyl benzene-1,3,5-tricarboxylate |
| InChIKey | KXGOWZRHSOJOLF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=CC(=C1)C(=O)OCC)C(=O)OCC |
Computed by PubChem (NCBI)
Synonyms:
triethyl benzene-1,3,5-tricarboxylate, Triethyl trimesate, Trimesic acid triethyl ester, Triethyl 1,3,5-benzenetricarboxylate, 1,3,5-Benzenetricarboxylic acid, triethyl ester, 1,3,5-triethyl benzene-1,3,5-tricarboxylate, ethyl 3,5-bis(ethoxycarbonyl)benzoate, Triethylbenzene-1,3,5-tricarboxylate, 1,3,5-Benzenetricarboxylic acid triethyl ester, Triethyl 1,5-benzenetricarboxylate