cas: 343-94-2 — see every product listed under this CAS number, including other names
Tryptamine (hydrochloride), 99.98% (CAS 343-94-2) is a chemical reagent available from Chemat. Available pack sizes: 25 g, 10mM/1mL, 100 g, 50 g, 1 g, 10 g, 5 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W014971-25 g |
| cas | 343-94-2 |
| size | 25 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 25 g | 723.72 Pln | |
| MedChemExpress | 10mM/1mL | 254.68 Pln | |
| MedChemExpress | 100 g | 1318.15 Pln | |
| MedChemExpress | 50 g | 983.78 Pln | |
| MedChemExpress | 1 g | 240.74 Pln | |
| MedChemExpress | 10 g | 454.37 Pln | |
| MedChemExpress | 5 g | 361.49 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.98% |
2-(1H-indol-3-yl)ethanamine;hydrochloride (CAS 343-94-2) is a chemical compound with the molecular formula C10H13ClN2 and a molecular weight of 196.67 g/mol. IUPAC name: 2-(1H-indol-3-yl)ethanamine;hydrochloride. InChIKey: KDFBGNBTTMPNIG-UHFFFAOYSA-N.
| Molecular formula | C10H13ClN2 |
|---|---|
| Molecular weight | 196.67 g/mol |
| IUPAC name | 2-(1H-indol-3-yl)ethanamine;hydrochloride |
| InChIKey | KDFBGNBTTMPNIG-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)CCN.Cl |
Computed by PubChem (NCBI)