Products 340257-60-5
CAS 340257-60-5 appears in our catalog under these names: Tryptamine–d4 (hydrochloride), Tryptamine-d4 HCl, Tryptamine-d4 Hydrochloride, >95% (HPLC), Tryptamine-alpha,alpha,beta,beta-d4 HCl, 97 atom % D, min 98% Chemical Purity, Tryptamine-d4 (hydrochloride), 99.53%. Offered by: GLPBio, Chemat Brand, TRC, CDN, MedChemExpress. Available pack sizes: 5mg, on request, 2,5mg, 25mg, 0,05g, 0,01g, 1mg, 5 mg.
1,1,2,2-tetradeuterio-2-(1H-indol-3-yl)ethanamine;hydrochloride (CAS 340257-60-5) is a chemical compound with the molecular formula C10H13ClN2 and a molecular weight of 200.70 g/mol. IUPAC name: 1,1,2,2-tetradeuterio-2-(1H-indol-3-yl)ethanamine;hydrochloride. InChIKey: KDFBGNBTTMPNIG-NXMSQKFDSA-N.
| Molecular formula | C10H13ClN2 |
|---|---|
| Molecular weight | 200.70 g/mol |
| IUPAC name | 1,1,2,2-tetradeuterio-2-(1H-indol-3-yl)ethanamine;hydrochloride |
| InChIKey | KDFBGNBTTMPNIG-NXMSQKFDSA-N |
| SMILES | [2H]C([2H])(C1=CNC2=CC=CC=C21)C([2H])([2H])N.Cl |
Computed by PubChem (NCBI)