CAS 2057-84-3 appears in our catalog under these names: Pentanal-2,4-dinitrophenylhydrazone, Valeraldehyde 2,4–Dinitrophenylhydrazone, Valeraldehyde 2,4-Dinitrophenylhydrazone, >98.0%(HPLC)(T), VALERALDEHYDE-DNPH, 1X1ML, 100UG/ML, &, N-VALERALDEHYDE 2,4-DINITROPHENYLHYDRAZONE, 98.0%, 98.0%. Offered by: Dr. Ehrenstorfer, GLPBio, TCI, Sigma-Aldrich, Chemat. Available pack sizes: 100mg, 10g, 1g, 5g, 1EA, 1x100mg, 1x10ml.
2,4-dinitro-N-[(E)-pentylideneamino]aniline (CAS 2057-84-3) is a chemical compound with the molecular formula C11H14N4O4 and a molecular weight of 266.25 g/mol. IUPAC name: 2,4-dinitro-N-[(E)-pentylideneamino]aniline. InChIKey: XGVOZGLOQUHZBZ-KPKJPENVSA-N.
| Molecular formula | C11H14N4O4 |
|---|---|
| Molecular weight | 266.25 g/mol |
| IUPAC name | 2,4-dinitro-N-[(E)-pentylideneamino]aniline |
| InChIKey | XGVOZGLOQUHZBZ-KPKJPENVSA-N |
| SMILES | CCCC/C=N/NC1=C(C=C(C=C1)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)