CAS 58910-37-5 is the registry number for 1-(2,4-Dinitrophenyl)-4-methylpiperazine, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1-(2,4-dinitrophenyl)-4-methylpiperazine (CAS 58910-37-5) is a chemical compound with the molecular formula C11H14N4O4 and a molecular weight of 266.25 g/mol. IUPAC name: 1-(2,4-dinitrophenyl)-4-methylpiperazine. InChIKey: ZEBGUAUODJBFEV-UHFFFAOYSA-N.
| Molecular formula | C11H14N4O4 |
|---|---|
| Molecular weight | 266.25 g/mol |
| IUPAC name | 1-(2,4-dinitrophenyl)-4-methylpiperazine |
| InChIKey | ZEBGUAUODJBFEV-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=C(C=C(C=C2)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)