CAS 14675-48-0 appears in our catalog under these names: (2R,3S,4R,5R)-2-(Hydroxymethyl)-5-(6-methyl-9H-purin-9-yl)tetrahydrofuran-3,4-diol, 98%, 6-MPR, 95+%, 6–Methylpurine riboside, 6-Methylpurine riboside, 96.92%. Offered by: Combi-blocks, AmBeed, GLPBio, MedChemExpress. Available pack sizes: 250mg, 1g, 5g, 5 mg.
(2R,3S,4R,5R)-2-(hydroxymethyl)-5-(6-methylpurin-9-yl)oxolane-3,4-diol (CAS 14675-48-0) is a chemical compound with the molecular formula C11H14N4O4 and a molecular weight of 266.25 g/mol. IUPAC name: (2R,3S,4R,5R)-2-(hydroxymethyl)-5-(6-methylpurin-9-yl)oxolane-3,4-diol. InChIKey: FIGBCBGMUIGJBD-PNHWDRBUSA-N.
| Molecular formula | C11H14N4O4 |
|---|---|
| Molecular weight | 266.25 g/mol |
| IUPAC name | (2R,3S,4R,5R)-2-(hydroxymethyl)-5-(6-methylpurin-9-yl)oxolane-3,4-diol |
| InChIKey | FIGBCBGMUIGJBD-PNHWDRBUSA-N |
| SMILES | CC1=C2C(=NC=N1)N(C=N2)[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O |
Computed by PubChem (NCBI)