Products 1346599-13-0
CAS 1346599-13-0 is the registry number for Doxofylline-d4. Offered by: Chemat Brand, TRC, MedChemExpress. Available pack sizes: on request, 25mg, 5 mg, 50 mg.
1,3-dimethyl-7-[(4,4,5,5-tetradeuterio-1,3-dioxolan-2-yl)methyl]purine-2,6-dione (CAS 1346599-13-0) is a chemical compound with the molecular formula C11H14N4O4 and a molecular weight of 270.28 g/mol. IUPAC name: 1,3-dimethyl-7-[(4,4,5,5-tetradeuterio-1,3-dioxolan-2-yl)methyl]purine-2,6-dione. InChIKey: HWXIGFIVGWUZAO-KHORGVISSA-N.
| Molecular formula | C11H14N4O4 |
|---|---|
| Molecular weight | 270.28 g/mol |
| IUPAC name | 1,3-dimethyl-7-[(4,4,5,5-tetradeuterio-1,3-dioxolan-2-yl)methyl]purine-2,6-dione |
| InChIKey | HWXIGFIVGWUZAO-KHORGVISSA-N |
| SMILES | [2H]C1(C(OC(O1)CN2C=NC3=C2C(=O)N(C(=O)N3C)C)([2H])[2H])[2H] |
Computed by PubChem (NCBI)