cas: 1161205-04-4 — see every product listed under this CAS number, including other names
VU0361737 99% (CAS 1161205-04-4) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A709934-5mg |
| cas | 1161205-04-4 |
| size | 5mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5mg | 120.06 Pln | |
| Ambeed | 10mg | 131.19 Pln | |
| Ambeed | 25mg | 153.44 Pln | |
| Ambeed | 50mg | 197.94 Pln | |
| Ambeed | 100mg | 264.69 Pln | |
| Ambeed | 250mg | 387.06 Pln | |
| Ambeed | 1g | 921.06 Pln |
| purity | 99% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A709934 |
N-(4-chloro-3-methoxyphenyl)pyridine-2-carboxamide (CAS 1161205-04-4) is a chemical compound with the molecular formula C13H11ClN2O2 and a molecular weight of 262.69 g/mol. IUPAC name: N-(4-chloro-3-methoxyphenyl)pyridine-2-carboxamide. InChIKey: ARYUXFNGXHNNDM-UHFFFAOYSA-N.
| Molecular formula | C13H11ClN2O2 |
|---|---|
| Molecular weight | 262.69 g/mol |
| IUPAC name | N-(4-chloro-3-methoxyphenyl)pyridine-2-carboxamide |
| InChIKey | ARYUXFNGXHNNDM-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)NC(=O)C2=CC=CC=N2)Cl |
Computed by PubChem (NCBI)