CAS 77858-21-0 appears in our catalog under these names: Velaresol/ 99.46% (existing batch purity), Velaresol, 5-(2-Formyl-3-hydroxyphenoxy)pentanoic acid, 99.46% ,, 99.46% ,, Velaresol, 99.59%, Velaresol (Standard). Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 1mg, 200mg.
5-(2-formyl-3-hydroxyphenoxy)pentanoic acid (CAS 77858-21-0) is a chemical compound with the molecular formula C12H14O5 and a molecular weight of 238.24 g/mol. IUPAC name: 5-(2-formyl-3-hydroxyphenoxy)pentanoic acid. InChIKey: NSUDGNLOXMLAEB-UHFFFAOYSA-N.
| Molecular formula | C12H14O5 |
|---|---|
| Molecular weight | 238.24 g/mol |
| IUPAC name | 5-(2-formyl-3-hydroxyphenoxy)pentanoic acid |
| InChIKey | NSUDGNLOXMLAEB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)OCCCCC(=O)O)C=O)O |
Computed by PubChem (NCBI)