Products 2131803-93-3
CAS 2131803-93-3 appears in our catalog under these names: WYC–210, WYC-210/ 99.98% (existing batch purity), WYC-210, WYC-210, 99.98% ,, 99.98% ,, WYC-210, 99.18%. Offered by: GLPBio, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 10mg, 25mg, 5mg, 50mg, 1mg, 100mg, 200mg, 5 mg.
2-[2-(4,4-dimethyl-1-oxo-2,3-dihydrothiochromen-6-yl)ethynyl]pyrimidine-5-carboxylic acid (CAS 2131803-93-3) is a chemical compound with the molecular formula C18H16N2O3S and a molecular weight of 340.4 g/mol. IUPAC name: 2-[2-(4,4-dimethyl-1-oxo-2,3-dihydrothiochromen-6-yl)ethynyl]pyrimidine-5-carboxylic acid. InChIKey: NENFGFHRYIOMTM-UHFFFAOYSA-N.
| Molecular formula | C18H16N2O3S |
|---|---|
| Molecular weight | 340.4 g/mol |
| IUPAC name | 2-[2-(4,4-dimethyl-1-oxo-2,3-dihydrothiochromen-6-yl)ethynyl]pyrimidine-5-carboxylic acid |
| InChIKey | NENFGFHRYIOMTM-UHFFFAOYSA-N |
| SMILES | CC1(CCS(=O)C2=C1C=C(C=C2)C#CC3=NC=C(C=N3)C(=O)O)C |
Computed by PubChem (NCBI)