CAS 2607143-50-8 appears in our catalog under these names: XST–14, XST-14/ 99.68% (existing batch purity), XST-14 99%, Methyl 4,6-diisopropoxy-1H-indole-2-carboxylate, XST-14, 99.26%. Offered by: GLPBio, TargetMol, Ambeed, Chemat, MedChemExpress. Available pack sizes: 50mg, 10mg, 100mg, 10mM (in 1ml dmso), 25mg, 5mg, 1mg, 250mg.
Methyl 4,6-di(propan-2-yloxy)-1H-indole-2-carboxylate (CAS 2607143-50-8) is a chemical compound with the molecular formula C16H21NO4 and a molecular weight of 291.34 g/mol. IUPAC name: methyl 4,6-di(propan-2-yloxy)-1H-indole-2-carboxylate. InChIKey: ZNFMBFABCSHXPM-UHFFFAOYSA-N.
| Molecular formula | C16H21NO4 |
|---|---|
| Molecular weight | 291.34 g/mol |
| IUPAC name | methyl 4,6-di(propan-2-yloxy)-1H-indole-2-carboxylate |
| InChIKey | ZNFMBFABCSHXPM-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=CC2=C(C=C(N2)C(=O)OC)C(=C1)OC(C)C |
Computed by PubChem (NCBI)