Products 62949-76-2
CAS 62949-76-2 appears in our catalog under these names: Xanthoangelol, Xanthoangelol/ 99.67% (existing batch purity), Xanthoangelol 99%, Xanthoangelol, 99.88%. Offered by: GLPBio, TargetMol, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 25mg, 50mg, 10 mg, 1 mg, 5 mg.
(E)-1-[3-[(2E)-3,7-dimethylocta-2,6-dienyl]-2,4-dihydroxyphenyl]-3-(4-hydroxyphenyl)prop-2-en-1-one (CAS 62949-76-2) is a chemical compound with the molecular formula C25H28O4 and a molecular weight of 392.5 g/mol. IUPAC name: (E)-1-[3-[(2E)-3,7-dimethylocta-2,6-dienyl]-2,4-dihydroxyphenyl]-3-(4-hydroxyphenyl)prop-2-en-1-one. InChIKey: LRSMBOSQWGHYCW-MDGZPELGSA-N.
| Molecular formula | C25H28O4 |
|---|---|
| Molecular weight | 392.5 g/mol |
| IUPAC name | (E)-1-[3-[(2E)-3,7-dimethylocta-2,6-dienyl]-2,4-dihydroxyphenyl]-3-(4-hydroxyphenyl)prop-2-en-1-one |
| InChIKey | LRSMBOSQWGHYCW-MDGZPELGSA-N |
| SMILES | CC(=CCC/C(=C/CC1=C(C=CC(=C1O)C(=O)/C=C/C2=CC=C(C=C2)O)O)/C)C |
Computed by PubChem (NCBI)