cas: 1218-35-5 — see every product listed under this CAS number, including other names
Xylometazoline (hydrochloride), 99.94% (CAS 1218-35-5) is a chemical reagent available from Chemat. Available pack sizes: 25 g, 1 g, 10 g, 5 g, 10mM/1mL, 500 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-B0475-25 g |
| cas | 1218-35-5 |
| size | 25 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 25 g | 1847.57 Pln | |
| MedChemExpress | 1 g | 333.62 Pln | |
| MedChemExpress | 10 g | 983.78 Pln | |
| MedChemExpress | 5 g | 663.35 Pln | |
| MedChemExpress | 10mM/1mL | 277.90 Pln | |
| MedChemExpress | 500 mg | 263.96 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.94% |
2-[(4-tert-butyl-2,6-dimethylphenyl)methyl]-4,5-dihydro-1H-imidazole;hydrochloride (CAS 1218-35-5) is a chemical compound with the molecular formula C16H25ClN2 and a molecular weight of 280.83 g/mol. IUPAC name: 2-[(4-tert-butyl-2,6-dimethylphenyl)methyl]-4,5-dihydro-1H-imidazole;hydrochloride. InChIKey: YGWFCQYETHJKNX-UHFFFAOYSA-N.
| Molecular formula | C16H25ClN2 |
|---|---|
| Molecular weight | 280.83 g/mol |
| IUPAC name | 2-[(4-tert-butyl-2,6-dimethylphenyl)methyl]-4,5-dihydro-1H-imidazole;hydrochloride |
| InChIKey | YGWFCQYETHJKNX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1CC2=NCCN2)C)C(C)(C)C.Cl |
Computed by PubChem (NCBI)