cas: 1218-35-5 — see every product listed under this CAS number, including other names
Xylometazoline Hydrochloride, >98.0%(HPLC)(N) (CAS 1218-35-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | X0063-1G |
| cas | 1218-35-5 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 247.68 Pln | |
| TCI | 5g | 547.64 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(HPLC)(N) |
2-[(4-tert-butyl-2,6-dimethylphenyl)methyl]-4,5-dihydro-1H-imidazole;hydrochloride (CAS 1218-35-5) is a chemical compound with the molecular formula C16H25ClN2 and a molecular weight of 280.83 g/mol. IUPAC name: 2-[(4-tert-butyl-2,6-dimethylphenyl)methyl]-4,5-dihydro-1H-imidazole;hydrochloride. InChIKey: YGWFCQYETHJKNX-UHFFFAOYSA-N.
| Molecular formula | C16H25ClN2 |
|---|---|
| Molecular weight | 280.83 g/mol |
| IUPAC name | 2-[(4-tert-butyl-2,6-dimethylphenyl)methyl]-4,5-dihydro-1H-imidazole;hydrochloride |
| InChIKey | YGWFCQYETHJKNX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1CC2=NCCN2)C)C(C)(C)C.Cl |
Computed by PubChem (NCBI)