cas: 1218-35-5 — see every product listed under this CAS number, including other names
Xylometazoline HCl 97% (CAS 1218-35-5) is a chemical reagent available from Chemat. Available pack sizes: 100g, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A124255-100g |
| cas | 1218-35-5 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100g | 1744.31 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 203.50 Pln | |
| Ambeed | 25g | 592.88 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A124255 |
2-[(4-tert-butyl-2,6-dimethylphenyl)methyl]-4,5-dihydro-1H-imidazole;hydrochloride (CAS 1218-35-5) is a chemical compound with the molecular formula C16H25ClN2 and a molecular weight of 280.83 g/mol. IUPAC name: 2-[(4-tert-butyl-2,6-dimethylphenyl)methyl]-4,5-dihydro-1H-imidazole;hydrochloride. InChIKey: YGWFCQYETHJKNX-UHFFFAOYSA-N.
| Molecular formula | C16H25ClN2 |
|---|---|
| Molecular weight | 280.83 g/mol |
| IUPAC name | 2-[(4-tert-butyl-2,6-dimethylphenyl)methyl]-4,5-dihydro-1H-imidazole;hydrochloride |
| InChIKey | YGWFCQYETHJKNX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1CC2=NCCN2)C)C(C)(C)C.Cl |
Computed by PubChem (NCBI)