cas: 67299-52-9 — see every product listed under this CAS number, including other names
Z-1,4-Cis-ACHC-OH 97% (CAS 67299-52-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A441477-250mg |
| cas | 67299-52-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 331.44 Pln | |
| Ambeed | 1g | 381.50 Pln | |
| Ambeed | 5g | 1327.12 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A441477 |
4-(phenylmethoxycarbonylamino)cyclohexane-1-carboxylic acid (CAS 67299-52-9) is a chemical compound with the molecular formula C15H19NO4 and a molecular weight of 277.31 g/mol. IUPAC name: 4-(phenylmethoxycarbonylamino)cyclohexane-1-carboxylic acid. InChIKey: ZVMICQYOGWAOSU-UHFFFAOYSA-N.
| Molecular formula | C15H19NO4 |
|---|---|
| Molecular weight | 277.31 g/mol |
| IUPAC name | 4-(phenylmethoxycarbonylamino)cyclohexane-1-carboxylic acid |
| InChIKey | ZVMICQYOGWAOSU-UHFFFAOYSA-N |
| SMILES | C1CC(CCC1C(=O)O)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)