Products 220851-34-3

CAS 220851-34-3 is the registry number for 4-([(Benzyloxy)carbonyl]amino)cyclohexane-1-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

4-(phenylmethoxycarbonylamino)cyclohexane-1-carboxylic acid (CAS 220851-34-3) is a chemical compound with the molecular formula C15H19NO4 and a molecular weight of 277.31 g/mol. IUPAC name: 4-(phenylmethoxycarbonylamino)cyclohexane-1-carboxylic acid. InChIKey: ZVMICQYOGWAOSU-UHFFFAOYSA-N.

Identity
Molecular formulaC15H19NO4
Molecular weight277.31 g/mol
IUPAC name4-(phenylmethoxycarbonylamino)cyclohexane-1-carboxylic acid
InChIKeyZVMICQYOGWAOSU-UHFFFAOYSA-N
SMILESC1CC(CCC1C(=O)O)NC(=O)OCC2=CC=CC=C2

Computed by PubChem (NCBI)