cas: 4779-31-1 — see every product listed under this CAS number, including other names
Z-Asp-OBzl, 97%, 97% (CAS 4779-31-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I9PE-250mg |
| cas | 4779-31-1 |
| size | 250mg |
| availability | 575g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 69.20 Pln | |
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 93.20 Pln | |
| Chemat | 25g | 131.60 Pln | |
| Chemat | 100g | 338.00 Pln | |
| Chemat | 500g | 1507.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(3S)-4-oxo-4-phenylmethoxy-3-(phenylmethoxycarbonylamino)butanoic acid (CAS 4779-31-1) is a chemical compound with the molecular formula C19H19NO6 and a molecular weight of 357.4 g/mol. IUPAC name: (3S)-4-oxo-4-phenylmethoxy-3-(phenylmethoxycarbonylamino)butanoic acid. InChIKey: UYOZWZKJQRBZRH-INIZCTEOSA-N.
| Molecular formula | C19H19NO6 |
|---|---|
| Molecular weight | 357.4 g/mol |
| IUPAC name | (3S)-4-oxo-4-phenylmethoxy-3-(phenylmethoxycarbonylamino)butanoic acid |
| InChIKey | UYOZWZKJQRBZRH-INIZCTEOSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)[C@H](CC(=O)O)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)