Products 29880-21-5

CAS 29880-21-5 is the registry number for Z-D,L-Asp(OBzl)-OH, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g.

Structural formula: {0} (CAS {1})

4-oxo-4-phenylmethoxy-2-(phenylmethoxycarbonylamino)butanoic acid (CAS 29880-21-5) is a chemical compound with the molecular formula C19H19NO6 and a molecular weight of 357.4 g/mol. IUPAC name: 4-oxo-4-phenylmethoxy-2-(phenylmethoxycarbonylamino)butanoic acid. InChIKey: VUKCNAATVIWRTF-UHFFFAOYSA-N.

Identity
Molecular formulaC19H19NO6
Molecular weight357.4 g/mol
IUPAC name4-oxo-4-phenylmethoxy-2-(phenylmethoxycarbonylamino)butanoic acid
InChIKeyVUKCNAATVIWRTF-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)COC(=O)CC(C(=O)O)NC(=O)OCC2=CC=CC=C2

Computed by PubChem (NCBI)