CAS 81440-35-9 appears in our catalog under these names: (3R)–4–oxo–4–phenylmethoxy–3–(phenylmethoxycarbonylamino)butanoate, Cbz-D-Asp-OBzl 97%, (R)-4-(Benzyloxy)-3-(((benzyloxy)carbonyl)amino)-4-oxobutanoic acid, 97%, 97%. Offered by: GLPBio, Ambeed, Chemat. Available pack sizes: 1g, 5g, 250mg.
(3R)-4-oxo-4-phenylmethoxy-3-(phenylmethoxycarbonylamino)butanoic acid (CAS 81440-35-9) is a chemical compound with the molecular formula C19H19NO6 and a molecular weight of 357.4 g/mol. IUPAC name: (3R)-4-oxo-4-phenylmethoxy-3-(phenylmethoxycarbonylamino)butanoic acid. InChIKey: UYOZWZKJQRBZRH-MRXNPFEDSA-N.
| Molecular formula | C19H19NO6 |
|---|---|
| Molecular weight | 357.4 g/mol |
| IUPAC name | (3R)-4-oxo-4-phenylmethoxy-3-(phenylmethoxycarbonylamino)butanoic acid |
| InChIKey | UYOZWZKJQRBZRH-MRXNPFEDSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)[C@@H](CC(=O)O)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)