CAS 5241-62-3 appears in our catalog under these names: Z–D–Asp(OBzl)–OH, Cbz-D-Asp(OBzl)-OH 95%, Z-D-Asp(OBzl)-OH, 95%, 95%, Z-D-Asp-OBzl, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 250mg, 10g, 100g.
(2R)-4-oxo-4-phenylmethoxy-2-(phenylmethoxycarbonylamino)butanoic acid (CAS 5241-62-3) is a chemical compound with the molecular formula C19H19NO6 and a molecular weight of 357.4 g/mol. IUPAC name: (2R)-4-oxo-4-phenylmethoxy-2-(phenylmethoxycarbonylamino)butanoic acid. InChIKey: VUKCNAATVIWRTF-MRXNPFEDSA-N.
| Molecular formula | C19H19NO6 |
|---|---|
| Molecular weight | 357.4 g/mol |
| IUPAC name | (2R)-4-oxo-4-phenylmethoxy-2-(phenylmethoxycarbonylamino)butanoic acid |
| InChIKey | VUKCNAATVIWRTF-MRXNPFEDSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)C[C@H](C(=O)O)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)